C24H18F3N3O2 — CID 53316547
N-(2-methoxyphenyl)-1-[3-(trifluoromethyl)anilino]isoquinoline-4-carboxamide (PubChem CID 53316547) has the molecular formula C24H18F3N3O2 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-[3-(trifluoromethyl)anilino]isoquinoline-4-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-1-[3-(trifluoromethyl)anilino]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 53316547 |
| Molecular Formula | C24H18F3N3O2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-(2-methoxyphenyl)-1-[3-(trifluoromethyl)anilino]isoquinoline-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cnc(Nc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C24H18F3N3O2/c1-32-21-12-5-4-11-20(21)30-23(31)19-14-28-22(18-10-3-2-9-17(18)19)29-16-8-6-7-15(13-16)24(25,26)27/h2-14H,1H3,(H,28,29)(H,30,31) |
| InChIKey | ILGRAJKRIVZWIH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |