C28H21F3N4O2 — CID 127037355
1-[4-[(4-methoxyacridin-9-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 127037355) has the molecular formula C28H21F3N4O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is 1-[4-[(4-methoxyacridin-9-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[(4-methoxyacridin-9-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 127037355 |
| Molecular Formula | C28H21F3N4O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 1-[4-[(4-methoxyacridin-9-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cccc2c(Nc3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)c3ccccc3nc12 |
| InChI | InChI=1S/C28H21F3N4O2/c1-37-24-11-5-9-22-25(21-8-2-3-10-23(21)35-26(22)24)32-18-12-14-19(15-13-18)33-27(36)34-20-7-4-6-17(16-20)28(29,30)31/h2-16H,1H3,(H,32,35)(H2,33,34,36) |
| InChIKey | YXZXATDCQSYAIQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|