C22H16F3N5O2 — CID 162514679
1-[4-[(4-oxo-3H-phthalazin-1-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 162514679) has the molecular formula C22H16F3N5O2 and a molecular weight of 439.40 g/mol. Its IUPAC name is 1-[4-[(4-oxo-3H-phthalazin-1-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[(4-oxo-3H-phthalazin-1-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162514679 |
| Molecular Formula | C22H16F3N5O2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-[4-[(4-oxo-3H-phthalazin-1-yl)amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Nc2n[nH]c(=O)c3ccccc23)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N5O2/c23-22(24,25)13-4-3-5-16(12-13)28-21(32)27-15-10-8-14(9-11-15)26-19-17-6-1-2-7-18(17)20(31)30-29-19/h1-12H,(H,26,29)(H,30,31)(H2,27,28,32) |
| InChIKey | YBGJWKPSMJTZOD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |