C19H18F3N5OS — CID 20818762
1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 20818762) has the molecular formula C19H18F3N5OS and a molecular weight of 421.45 g/mol. Its IUPAC name is 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 20818762 |
| Molecular Formula | C19H18F3N5OS |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=c1[nH]nc(NCCCNC(=S)Nc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C19H18F3N5OS/c20-19(21,22)12-5-3-6-13(11-12)25-18(29)24-10-4-9-23-16-14-7-1-2-8-15(14)17(28)27-26-16/h1-3,5-8,11H,4,9-10H2,(H,23,26)(H,27,28)(H2,24,25,29) |
| InChIKey | JGUZAFXBOZCRED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|