C20H24N6OS — CID 20818782
1-[4-(dimethylamino)phenyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea (PubChem CID 20818782) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
|---|---|
| PubChem CID | 20818782 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)NCCCNc2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H24N6OS/c1-26(2)15-10-8-14(9-11-15)23-20(28)22-13-5-12-21-18-16-6-3-4-7-17(16)19(27)25-24-18/h3-4,6-11H,5,12-13H2,1-2H3,(H,21,24)(H,25,27)(H2,22,23,28) |
| InChIKey | PIACUVXJMFEIHF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|