C21H24FN5OS — CID 142215041
1-[3-(1-fluoroethyl)phenyl]-3-[3-[methyl-(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea (PubChem CID 142215041) has the molecular formula C21H24FN5OS and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[3-(1-fluoroethyl)phenyl]-3-[3-[methyl-(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea.
| Compound Name | 1-[3-(1-fluoroethyl)phenyl]-3-[3-[methyl-(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
|---|---|
| PubChem CID | 142215041 |
| Molecular Formula | C21H24FN5OS |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-[3-(1-fluoroethyl)phenyl]-3-[3-[methyl-(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
| SMILES | CC(F)c1cccc(NC(=S)NCCCN(C)c2n[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C21H24FN5OS/c1-14(22)15-7-5-8-16(13-15)24-21(29)23-11-6-12-27(2)19-17-9-3-4-10-18(17)20(28)26-25-19/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H,26,28)(H2,23,24,29) |
| InChIKey | IRESALKFGVHVGU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|