C24H31ClN4O2 — CID 23449597
5-[methyl(2-methylpropyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride (PubChem CID 23449597) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 5-[methyl(2-methylpropyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride.
| Compound Name | 5-[methyl(2-methylpropyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 23449597 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 5-[methyl(2-methylpropyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
| SMILES | CC(C)CN(C)CCCCC(=O)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1.Cl |
| InChI | InChI=1S/C24H30N4O2.ClH/c1-17(2)16-28(3)14-7-6-13-22(29)25-19-10-8-9-18(15-19)23-20-11-4-5-12-21(20)24(30)27-26-23;/h4-5,8-12,15,17H,6-7,13-14,16H2,1-3H3,(H,25,29)(H,27,30);1H |
| InChIKey | YTPGEAGPJRPCJV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|