C23H26N4O2S — CID 23449742
N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-thiomorpholin-4-ylpentanamide (PubChem CID 23449742) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-thiomorpholin-4-ylpentanamide.
| Compound Name | N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-thiomorpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 23449742 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-thiomorpholin-4-ylpentanamide |
| SMILES | O=C(CCCCN1CCSCC1)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C23H26N4O2S/c28-21(10-3-4-11-27-12-14-30-15-13-27)24-18-7-5-6-17(16-18)22-19-8-1-2-9-20(19)23(29)26-25-22/h1-2,5-9,16H,3-4,10-15H2,(H,24,28)(H,26,29) |
| InChIKey | NMMRJLRDNPBTPA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|