C26H33ClN4O3 — CID 23449738
5-[3-(methoxymethyl)piperidin-1-yl]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride (PubChem CID 23449738) has the molecular formula C26H33ClN4O3 and a molecular weight of 485.03 g/mol. Its IUPAC name is 5-[3-(methoxymethyl)piperidin-1-yl]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride.
| Compound Name | 5-[3-(methoxymethyl)piperidin-1-yl]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 23449738 |
| Molecular Formula | C26H33ClN4O3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 5-[3-(methoxymethyl)piperidin-1-yl]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
| SMILES | COCC1CCCN(CCCCC(=O)Nc2cccc(-c3n[nH]c(=O)c4ccccc34)c2)C1.Cl |
| InChI | InChI=1S/C26H32N4O3.ClH/c1-33-18-19-8-7-15-30(17-19)14-5-4-13-24(31)27-21-10-6-9-20(16-21)25-22-11-2-3-12-23(22)26(32)29-28-25;/h2-3,6,9-12,16,19H,4-5,7-8,13-15,17-18H2,1H3,(H,27,31)(H,29,32);1H |
| InChIKey | KSCBPJBCLYPSIB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|