C22H27ClN4O2 — CID 23449430
5-[ethyl(methyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride (PubChem CID 23449430) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride.
| Compound Name | 5-[ethyl(methyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 23449430 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 5-[ethyl(methyl)amino]-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
| SMILES | CCN(C)CCCCC(=O)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1.Cl |
| InChI | InChI=1S/C22H26N4O2.ClH/c1-3-26(2)14-7-6-13-20(27)23-17-10-8-9-16(15-17)21-18-11-4-5-12-19(18)22(28)25-24-21;/h4-5,8-12,15H,3,6-7,13-14H2,1-2H3,(H,23,27)(H,25,28);1H |
| InChIKey | HVPODTKXIMMOGI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|