C24H24N4O3 — CID 23449499
5-(furan-2-ylmethylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide (PubChem CID 23449499) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 5-(furan-2-ylmethylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide.
| Compound Name | 5-(furan-2-ylmethylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 23449499 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 5-(furan-2-ylmethylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide |
| SMILES | O=C(CCCCNCc1ccco1)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C24H24N4O3/c29-22(12-3-4-13-25-16-19-9-6-14-31-19)26-18-8-5-7-17(15-18)23-20-10-1-2-11-21(20)24(30)28-27-23/h1-2,5-11,14-15,25H,3-4,12-13,16H2,(H,26,29)(H,28,30) |
| InChIKey | KJGHJTVVDDKIIT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|