C18H19N5OS — CID 23449507
1-(3-aminopropyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea (PubChem CID 23449507) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea.
| Compound Name | 1-(3-aminopropyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 23449507 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-(3-aminopropyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea |
| SMILES | NCCCNC(=S)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C18H19N5OS/c19-9-4-10-20-18(25)21-13-6-3-5-12(11-13)16-14-7-1-2-8-15(14)17(24)23-22-16/h1-3,5-8,11H,4,9-10,19H2,(H,23,24)(H2,20,21,25) |
| InChIKey | DPXHHLDZPLOVBZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|