C21H24ClN5O2S — CID 23449447
1-(2-morpholin-4-ylethyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea;hydrochloride (PubChem CID 23449447) has the molecular formula C21H24ClN5O2S and a molecular weight of 445.98 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea;hydrochloride.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 23449447 |
| Molecular Formula | C21H24ClN5O2S |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]thiourea;hydrochloride |
| SMILES | Cl.O=c1[nH]nc(-c2cccc(NC(=S)NCCN3CCOCC3)c2)c2ccccc12 |
| InChI | InChI=1S/C21H23N5O2S.ClH/c27-20-18-7-2-1-6-17(18)19(24-25-20)15-4-3-5-16(14-15)23-21(29)22-8-9-26-10-12-28-13-11-26;/h1-7,14H,8-13H2,(H,25,27)(H2,22,23,29);1H |
| InChIKey | GEJHPUPKDDJJDK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|