C20H26N4OS — CID 8679916
1-(3-anilinophenyl)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8679916) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-(3-anilinophenyl)-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-(3-anilinophenyl)-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8679916 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(3-anilinophenyl)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | S=C(NCCCN1CCOCC1)Nc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N4OS/c26-20(21-10-5-11-24-12-14-25-15-13-24)23-19-9-4-8-18(16-19)22-17-6-2-1-3-7-17/h1-4,6-9,16,22H,5,10-15H2,(H2,21,23,26) |
| InChIKey | OOPWOFGVUBDYSI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|