C15H21F2N3OS2 — CID 2373595
1-[4-(difluoromethylsulfanyl)phenyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 2373595) has the molecular formula C15H21F2N3OS2 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 2373595 |
| Molecular Formula | C15H21F2N3OS2 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H21F2N3OS2/c16-14(17)23-13-4-2-12(3-5-13)19-15(22)18-6-1-7-20-8-10-21-11-9-20/h2-5,14H,1,6-11H2,(H2,18,19,22) |
| InChIKey | KDSVECDDTOVBTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|