C14H18F2N2O2S — CID 136580272
N-[4-(difluoromethylsulfanyl)phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 136580272) has the molecular formula C14H18F2N2O2S and a molecular weight of 316.37 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 136580272 |
| Molecular Formula | C14H18F2N2O2S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | O=C(CCN1CCOCC1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C14H18F2N2O2S/c15-14(16)21-12-3-1-11(2-4-12)17-13(19)5-6-18-7-9-20-10-8-18/h1-4,14H,5-10H2,(H,17,19) |
| InChIKey | NDZFVSXFBIVKEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |