C23H26Cl2N4O3 — CID 23449463
N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-morpholin-4-ylpentanamide;hydrochloride (PubChem CID 23449463) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-morpholin-4-ylpentanamide;hydrochloride.
| Compound Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-morpholin-4-ylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 23449463 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-morpholin-4-ylpentanamide;hydrochloride |
| SMILES | Cl.O=C(CCCCN1CCOCC1)Nc1cc(-c2n[nH]c(=O)c3ccccc23)ccc1Cl |
| InChI | InChI=1S/C23H25ClN4O3.ClH/c24-19-9-8-16(22-17-5-1-2-6-18(17)23(30)27-26-22)15-20(19)25-21(29)7-3-4-10-28-11-13-31-14-12-28;/h1-2,5-6,8-9,15H,3-4,7,10-14H2,(H,25,29)(H,27,30);1H |
| InChIKey | INKAVCDBPAAUSU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|