C25H29ClN4O2 — CID 23449476
N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclohexylamino)pentanamide (PubChem CID 23449476) has the molecular formula C25H29ClN4O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclohexylamino)pentanamide.
| Compound Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclohexylamino)pentanamide |
|---|---|
| PubChem CID | 23449476 |
| Molecular Formula | C25H29ClN4O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclohexylamino)pentanamide |
| SMILES | O=C(CCCCNC1CCCCC1)Nc1cc(-c2n[nH]c(=O)c3ccccc23)ccc1Cl |
| InChI | InChI=1S/C25H29ClN4O2/c26-21-14-13-17(24-19-10-4-5-11-20(19)25(32)30-29-24)16-22(21)28-23(31)12-6-7-15-27-18-8-2-1-3-9-18/h4-5,10-11,13-14,16,18,27H,1-3,6-9,12,15H2,(H,28,31)(H,30,32) |
| InChIKey | HZJFJLFIDMUCIR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|