C24H28Cl2N4O2 — CID 23449737
N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclopentylamino)pentanamide;hydrochloride (PubChem CID 23449737) has the molecular formula C24H28Cl2N4O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclopentylamino)pentanamide;hydrochloride.
| Compound Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclopentylamino)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 23449737 |
| Molecular Formula | C24H28Cl2N4O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(cyclopentylamino)pentanamide;hydrochloride |
| SMILES | Cl.O=C(CCCCNC1CCCC1)Nc1cc(-c2n[nH]c(=O)c3ccccc23)ccc1Cl |
| InChI | InChI=1S/C24H27ClN4O2.ClH/c25-20-13-12-16(23-18-9-3-4-10-19(18)24(31)29-28-23)15-21(20)27-22(30)11-5-6-14-26-17-7-1-2-8-17;/h3-4,9-10,12-13,15,17,26H,1-2,5-8,11,14H2,(H,27,30)(H,29,31);1H |
| InChIKey | LFXVXCUZXMNTQS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|