C20H21Cl2FN4O2 — CID 142651577
N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(fluoromethylamino)pentanamide;hydrochloride (PubChem CID 142651577) has the molecular formula C20H21Cl2FN4O2 and a molecular weight of 439.32 g/mol. Its IUPAC name is N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(fluoromethylamino)pentanamide;hydrochloride.
| Compound Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(fluoromethylamino)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 142651577 |
| Molecular Formula | C20H21Cl2FN4O2 |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-[2-chloro-5-(4-oxo-3H-phthalazin-1-yl)phenyl]-5-(fluoromethylamino)pentanamide;hydrochloride |
| SMILES | Cl.O=C(CCCCNCF)Nc1cc(-c2n[nH]c(=O)c3ccccc23)ccc1Cl |
| InChI | InChI=1S/C20H20ClFN4O2.ClH/c21-16-9-8-13(11-17(16)24-18(27)7-3-4-10-23-12-22)19-14-5-1-2-6-15(14)20(28)26-25-19;/h1-2,5-6,8-9,11,23H,3-4,7,10,12H2,(H,24,27)(H,26,28);1H |
| InChIKey | UTEPEVPKQPXPLA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|