C23H27ClN4O2 — CID 23449725
5-(2-methylprop-2-enylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride (PubChem CID 23449725) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 5-(2-methylprop-2-enylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride.
| Compound Name | 5-(2-methylprop-2-enylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 23449725 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 5-(2-methylprop-2-enylamino)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]pentanamide;hydrochloride |
| SMILES | C=C(C)CNCCCCC(=O)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1.Cl |
| InChI | InChI=1S/C23H26N4O2.ClH/c1-16(2)15-24-13-6-5-12-21(28)25-18-9-7-8-17(14-18)22-19-10-3-4-11-20(19)23(29)27-26-22;/h3-4,7-11,14,24H,1,5-6,12-13,15H2,2H3,(H,25,28)(H,27,29);1H |
| InChIKey | VOLVVHBLGFBKPG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|