C20H28N6OS — CID 4842203
1-(2-morpholin-4-ylethyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea (PubChem CID 4842203) has the molecular formula C20H28N6OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 4842203 |
| Molecular Formula | C20H28N6OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
| SMILES | S=C(NCCN1CCOCC1)Nc1cccc(-c2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C20H28N6OS/c28-20(21-8-10-25-11-13-27-14-12-25)22-17-6-4-5-16(15-17)19-24-23-18-7-2-1-3-9-26(18)19/h4-6,15H,1-3,7-14H2,(H2,21,22,28) |
| InChIKey | NCXDSDZRLDINGI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|