C21H22N4O — CID 91889057
4-ethyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]benzamide (PubChem CID 91889057) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-ethyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]benzamide.
| Compound Name | 4-ethyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 91889057 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-ethyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]benzamide |
| SMILES | CCc1ccc(C(=O)Nc2cccc(-c3nnc4n3CCCC4)c2)cc1 |
| InChI | InChI=1S/C21H22N4O/c1-2-15-9-11-16(12-10-15)21(26)22-18-7-5-6-17(14-18)20-24-23-19-8-3-4-13-25(19)20/h5-7,9-12,14H,2-4,8,13H2,1H3,(H,22,26) |
| InChIKey | WWAGCRCUXOPLIF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |