C18H20N6OS — CID 9206575
4-ethyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiadiazole-5-carboxamide (PubChem CID 9206575) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-ethyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 9206575 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-ethyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1cccc(-c2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C18H20N6OS/c1-2-14-16(26-23-20-14)18(25)19-13-8-6-7-12(11-13)17-22-21-15-9-4-3-5-10-24(15)17/h6-8,11H,2-5,9-10H2,1H3,(H,19,25) |
| InChIKey | VQHBWZINJYGRGO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |