C18H18N4OS — CID 91889062
3-methyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]thiophene-2-carboxamide (PubChem CID 91889062) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 3-methyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91889062 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-methyl-N-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1cccc(-c2nnc3n2CCCC3)c1 |
| InChI | InChI=1S/C18H18N4OS/c1-12-8-10-24-16(12)18(23)19-14-6-4-5-13(11-14)17-21-20-15-7-2-3-9-22(15)17/h4-6,8,10-11H,2-3,7,9H2,1H3,(H,19,23) |
| InChIKey | MYUORTGATNSKFU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |