C23H27N5OS — CID 18206253
1-[2-(4-methoxyphenyl)ethyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea (PubChem CID 18206253) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 18206253 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2cccc(-c3nnc4n3CCCCC4)c2)cc1 |
| InChI | InChI=1S/C23H27N5OS/c1-29-20-11-9-17(10-12-20)13-14-24-23(30)25-19-7-5-6-18(16-19)22-27-26-21-8-3-2-4-15-28(21)22/h5-7,9-12,16H,2-4,8,13-15H2,1H3,(H2,24,25,30) |
| InChIKey | RGWVSLATNDAJGD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|