C24H31ClN4O4S — CID 23449490
4-(3-methoxypiperidin-1-yl)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]butane-1-sulfonamide;hydrochloride (PubChem CID 23449490) has the molecular formula C24H31ClN4O4S and a molecular weight of 507.06 g/mol. Its IUPAC name is 4-(3-methoxypiperidin-1-yl)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]butane-1-sulfonamide;hydrochloride.
| Compound Name | 4-(3-methoxypiperidin-1-yl)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]butane-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 23449490 |
| Molecular Formula | C24H31ClN4O4S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-(3-methoxypiperidin-1-yl)-N-[3-(4-oxo-3H-phthalazin-1-yl)phenyl]butane-1-sulfonamide;hydrochloride |
| SMILES | COC1CCCN(CCCCS(=O)(=O)Nc2cccc(-c3n[nH]c(=O)c4ccccc34)c2)C1.Cl |
| InChI | InChI=1S/C24H30N4O4S.ClH/c1-32-20-10-7-14-28(17-20)13-4-5-15-33(30,31)27-19-9-6-8-18(16-19)23-21-11-2-3-12-22(21)24(29)26-25-23;/h2-3,6,8-9,11-12,16,20,27H,4-5,7,10,13-15,17H2,1H3,(H,26,29);1H |
| InChIKey | YDPLEBVUWPYSHQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|