C25H25N5O2S — CID 20818779
1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-(4-phenylmethoxyphenyl)thiourea (PubChem CID 20818779) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-(4-phenylmethoxyphenyl)thiourea.
| Compound Name | 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-(4-phenylmethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 20818779 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-(4-phenylmethoxyphenyl)thiourea |
| SMILES | O=c1[nH]nc(NCCCNC(=S)Nc2ccc(OCc3ccccc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H25N5O2S/c31-24-22-10-5-4-9-21(22)23(29-30-24)26-15-6-16-27-25(33)28-19-11-13-20(14-12-19)32-17-18-7-2-1-3-8-18/h1-5,7-14H,6,15-17H2,(H,26,29)(H,30,31)(H2,27,28,33) |
| InChIKey | XIWVOUMLPQRTOH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|