C36H34N4O4 — CID 20819099
4-[3-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one (PubChem CID 20819099) has the molecular formula C36H34N4O4 and a molecular weight of 586.69 g/mol. Its IUPAC name is 4-[3-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one.
| Compound Name | 4-[3-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 20819099 |
| Molecular Formula | C36H34N4O4 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 4-[3-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one |
| SMILES | O=C1C=CN(CCCNc2n[nH]c(=O)c3ccccc23)C(c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C36H34N4O4/c41-29-18-21-40(20-9-19-37-35-30-14-7-8-15-31(30)36(42)39-38-35)32(23-29)28-16-17-33(43-24-26-10-3-1-4-11-26)34(22-28)44-25-27-12-5-2-6-13-27/h1-8,10-18,21-22,32H,9,19-20,23-25H2,(H,37,38)(H,39,42) |
| InChIKey | ACSHFMHVASYXIR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|