C19H20N4O2S — CID 20819446
N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-2-phenylsulfanylacetamide (PubChem CID 20819446) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 20819446 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H20N4O2S/c24-17(13-26-14-7-2-1-3-8-14)20-11-6-12-21-18-15-9-4-5-10-16(15)19(25)23-22-18/h1-5,7-10H,6,11-13H2,(H,20,24)(H,21,22)(H,23,25) |
| InChIKey | ZSFUZNIUTWZRAI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|