C27H26N4O4 — CID 20819178
4-[4-[3-oxo-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propylamino]propyl]phenyl]benzoic acid (PubChem CID 20819178) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[4-[3-oxo-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propylamino]propyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[3-oxo-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propylamino]propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 20819178 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-[4-[3-oxo-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propylamino]propyl]phenyl]benzoic acid |
| SMILES | O=C(CCc1ccc(-c2ccc(C(=O)O)cc2)cc1)NCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C27H26N4O4/c32-24(28-16-3-17-29-25-22-4-1-2-5-23(22)26(33)31-30-25)15-8-18-6-9-19(10-7-18)20-11-13-21(14-12-20)27(34)35/h1-2,4-7,9-14H,3,8,15-17H2,(H,28,32)(H,29,30)(H,31,33)(H,34,35) |
| InChIKey | HFFAEDYMHMVGFZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|