C20H22N4O3S — CID 20819233
5-oxo-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-5-thiophen-2-ylpentanamide (PubChem CID 20819233) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 5-oxo-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-5-thiophen-2-ylpentanamide.
| Compound Name | 5-oxo-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 20819233 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-oxo-N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-5-thiophen-2-ylpentanamide |
| SMILES | O=C(CCCC(=O)c1cccs1)NCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H22N4O3S/c25-16(17-9-4-13-28-17)8-3-10-18(26)21-11-5-12-22-19-14-6-1-2-7-15(14)20(27)24-23-19/h1-2,4,6-7,9,13H,3,5,8,10-12H2,(H,21,26)(H,22,23)(H,24,27) |
| InChIKey | MYIMHQXPSCRTSZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|