C22H25N7O3 — CID 20819549
N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-3-(3-pyridin-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 20819549) has the molecular formula C22H25N7O3 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-3-(3-pyridin-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-3-(3-pyridin-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 20819549 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-3-(3-pyridin-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | O=C(CCC1N=C(c2ccccn2)NO1)NCCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H25N7O3/c30-18(10-11-19-26-21(29-32-19)17-9-3-4-12-23-17)24-13-5-6-14-25-20-15-7-1-2-8-16(15)22(31)28-27-20/h1-4,7-9,12,19H,5-6,10-11,13-14H2,(H,24,30)(H,25,27)(H,26,29)(H,28,31) |
| InChIKey | FPOKHKVMMXBBPZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|