C25H30N6O4 — CID 20819152
4-[3-(4-methoxyphenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]butanamide (PubChem CID 20819152) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]butanamide.
| Compound Name | 4-[3-(4-methoxyphenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]butanamide |
|---|---|
| PubChem CID | 20819152 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]butanamide |
| SMILES | COc1ccc(C2N=C(CCCC(=O)NCCCCNc3n[nH]c(=O)c4ccccc34)ON2)cc1 |
| InChI | InChI=1S/C25H30N6O4/c1-34-18-13-11-17(12-14-18)23-28-22(35-31-23)10-6-9-21(32)26-15-4-5-16-27-24-19-7-2-3-8-20(19)25(33)30-29-24/h2-3,7-8,11-14,23,31H,4-6,9-10,15-16H2,1H3,(H,26,32)(H,27,29)(H,30,33) |
| InChIKey | JZEATDYAVWJKHX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|