C25H28Cl2N6O3 — CID 20819129
4-[3-(3,5-dichlorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[2,2-dimethyl-3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]butanamide (PubChem CID 20819129) has the molecular formula C25H28Cl2N6O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[2,2-dimethyl-3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]butanamide.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[2,2-dimethyl-3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]butanamide |
|---|---|
| PubChem CID | 20819129 |
| Molecular Formula | C25H28Cl2N6O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-N-[2,2-dimethyl-3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]butanamide |
| SMILES | CC(C)(CNC(=O)CCCC1=NC(c2cc(Cl)cc(Cl)c2)NO1)CNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H28Cl2N6O3/c1-25(2,14-29-23-18-6-3-4-7-19(18)24(35)32-31-23)13-28-20(34)8-5-9-21-30-22(33-36-21)15-10-16(26)12-17(27)11-15/h3-4,6-7,10-12,22,33H,5,8-9,13-14H2,1-2H3,(H,28,34)(H,29,31)(H,32,35) |
| InChIKey | GLXKNLYRTDAWAP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |