C21H21N7O3 — CID 20819546
N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetamide (PubChem CID 20819546) has the molecular formula C21H21N7O3 and a molecular weight of 419.45 g/mol. Its IUPAC name is N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetamide.
| Compound Name | N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 20819546 |
| Molecular Formula | C21H21N7O3 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[4-[(4-oxo-3H-phthalazin-1-yl)amino]butyl]-2-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)acetamide |
| SMILES | O=C(Cc1nc(-c2ccccn2)no1)NCCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H21N7O3/c29-17(13-18-25-20(28-31-18)16-9-3-4-10-22-16)23-11-5-6-12-24-19-14-7-1-2-8-15(14)21(30)27-26-19/h1-4,7-10H,5-6,11-13H2,(H,23,29)(H,24,26)(H,27,30) |
| InChIKey | PHGGZVWIENTSPB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|