C18H18N4O3 — CID 20819597
phenyl N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]carbamate (PubChem CID 20819597) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is phenyl N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]carbamate.
| Compound Name | phenyl N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 20819597 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | phenyl N-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]carbamate |
| SMILES | O=C(NCCCNc1n[nH]c(=O)c2ccccc12)Oc1ccccc1 |
| InChI | InChI=1S/C18H18N4O3/c23-17-15-10-5-4-9-14(15)16(21-22-17)19-11-6-12-20-18(24)25-13-7-2-1-3-8-13/h1-5,7-10H,6,11-12H2,(H,19,21)(H,20,24)(H,22,23) |
| InChIKey | CFFARYSMDKPFOJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|