C16H24N5O5P — CID 20818795
1-diethoxyphosphoryl-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]urea (PubChem CID 20818795) has the molecular formula C16H24N5O5P and a molecular weight of 397.37 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]urea.
| Compound Name | 1-diethoxyphosphoryl-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]urea |
|---|---|
| PubChem CID | 20818795 |
| Molecular Formula | C16H24N5O5P |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-diethoxyphosphoryl-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]urea |
| SMILES | CCOP(=O)(NC(=O)NCCCNc1n[nH]c(=O)c2ccccc12)OCC |
| InChI | InChI=1S/C16H24N5O5P/c1-3-25-27(24,26-4-2)21-16(23)18-11-7-10-17-14-12-8-5-6-9-13(12)15(22)20-19-14/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H,17,19)(H,20,22)(H2,18,21,23,24) |
| InChIKey | BJVROLAXUPREOM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|