C23H29N5O3S — CID 20818776
1-[(3-ethyl-4,5-dimethoxyphenyl)methyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea (PubChem CID 20818776) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-[(3-ethyl-4,5-dimethoxyphenyl)methyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea.
| Compound Name | 1-[(3-ethyl-4,5-dimethoxyphenyl)methyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
|---|---|
| PubChem CID | 20818776 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-[(3-ethyl-4,5-dimethoxyphenyl)methyl]-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
| SMILES | CCc1cc(CNC(=S)NCCCNc2n[nH]c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N5O3S/c1-4-16-12-15(13-19(30-2)20(16)31-3)14-26-23(32)25-11-7-10-24-21-17-8-5-6-9-18(17)22(29)28-27-21/h5-6,8-9,12-13H,4,7,10-11,14H2,1-3H3,(H,24,27)(H,28,29)(H2,25,26,32) |
| InChIKey | CLBDJNFSESUIEZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|