C20H23N5O2S — CID 20818750
1-(2-methoxy-5-methylphenyl)-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea (PubChem CID 20818750) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
|---|---|
| PubChem CID | 20818750 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)NCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H23N5O2S/c1-13-8-9-17(27-2)16(12-13)23-20(28)22-11-5-10-21-18-14-6-3-4-7-15(14)19(26)25-24-18/h3-4,6-9,12H,5,10-11H2,1-2H3,(H,21,24)(H,25,26)(H2,22,23,28) |
| InChIKey | ZKXSLMKEGFGQIU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|