C13H20N4O — CID 142215324
4-(3-aminopropylamino)-2H-phthalazin-1-one;ethane (PubChem CID 142215324) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(3-aminopropylamino)-2H-phthalazin-1-one;ethane.
| Compound Name | 4-(3-aminopropylamino)-2H-phthalazin-1-one;ethane |
|---|---|
| PubChem CID | 142215324 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-(3-aminopropylamino)-2H-phthalazin-1-one;ethane |
| SMILES | CC.NCCCNc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C11H14N4O.C2H6/c12-6-3-7-13-10-8-4-1-2-5-9(8)11(16)15-14-10;1-2/h1-2,4-5H,3,6-7,12H2,(H,13,14)(H,15,16);1-2H3 |
| InChIKey | ZRILMJHGWQUJJQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|