C23H27N5O3 — CID 20819596
N'-methyl-N'-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-N-phenylpentanediamide (PubChem CID 20819596) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N'-methyl-N'-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-N-phenylpentanediamide.
| Compound Name | N'-methyl-N'-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-N-phenylpentanediamide |
|---|---|
| PubChem CID | 20819596 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N'-methyl-N'-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-N-phenylpentanediamide |
| SMILES | CN(CCCNc1n[nH]c(=O)c2ccccc12)C(=O)CCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H27N5O3/c1-28(21(30)14-7-13-20(29)25-17-9-3-2-4-10-17)16-8-15-24-22-18-11-5-6-12-19(18)23(31)27-26-22/h2-6,9-12H,7-8,13-16H2,1H3,(H,24,26)(H,25,29)(H,27,31) |
| InChIKey | BNUVTHSEDFXTGT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|