C19H18F3N5O2S — CID 20818764
1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 20818764) has the molecular formula C19H18F3N5O2S and a molecular weight of 437.45 g/mol. Its IUPAC name is 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 20818764 |
| Molecular Formula | C19H18F3N5O2S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-[3-[(4-oxo-3H-phthalazin-1-yl)amino]propyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(NCCCNc1n[nH]c(=O)c2ccccc12)Nc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N5O2S/c20-19(21,22)30-13-6-3-5-12(11-13)25-18(29)24-10-4-9-23-16-14-7-1-2-8-15(14)17(28)27-26-16/h1-3,5-8,11H,4,9-10H2,(H,23,26)(H,27,28)(H2,24,25,29) |
| InChIKey | WUQHGNOPDGNZBH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|