C19H18N2O3S — CID 110616660
5-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-5-thiophen-2-ylpentanamide (PubChem CID 110616660) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 5-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-5-thiophen-2-ylpentanamide.
| Compound Name | 5-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 110616660 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-oxo-N-[(2-oxo-1H-quinolin-3-yl)methyl]-5-thiophen-2-ylpentanamide |
| SMILES | O=C(CCCC(=O)c1cccs1)NCc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H18N2O3S/c22-16(17-8-4-10-25-17)7-3-9-18(23)20-12-14-11-13-5-1-2-6-15(13)21-19(14)24/h1-2,4-6,8,10-11H,3,7,9,12H2,(H,20,23)(H,21,24) |
| InChIKey | ILBRWFMTAXFZAI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |