C24H26N4O4 — CID 20819108
4-[3-[2-(3-ethoxy-2-hydroxyphenyl)-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one (PubChem CID 20819108) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-[3-[2-(3-ethoxy-2-hydroxyphenyl)-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one.
| Compound Name | 4-[3-[2-(3-ethoxy-2-hydroxyphenyl)-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 20819108 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-[3-[2-(3-ethoxy-2-hydroxyphenyl)-4-oxo-2,3-dihydropyridin-1-yl]propylamino]-2H-phthalazin-1-one |
| SMILES | CCOc1cccc(C2CC(=O)C=CN2CCCNc2n[nH]c(=O)c3ccccc23)c1O |
| InChI | InChI=1S/C24H26N4O4/c1-2-32-21-10-5-9-19(22(21)30)20-15-16(29)11-14-28(20)13-6-12-25-23-17-7-3-4-8-18(17)24(31)27-26-23/h3-5,7-11,14,20,30H,2,6,12-13,15H2,1H3,(H,25,26)(H,27,31) |
| InChIKey | YPXVGPZEXVMHMX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|