C20H13F3N2O2 — CID 2421709
1-dibenzofuran-2-yl-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 2421709) has the molecular formula C20H13F3N2O2 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-dibenzofuran-2-yl-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-dibenzofuran-2-yl-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 2421709 |
| Molecular Formula | C20H13F3N2O2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-dibenzofuran-2-yl-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C20H13F3N2O2/c21-20(22,23)12-4-3-5-13(10-12)24-19(26)25-14-8-9-18-16(11-14)15-6-1-2-7-17(15)27-18/h1-11H,(H2,24,25,26) |
| InChIKey | NVJBEVSUODWDLH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |