C14H8F3NO2 — CID 5196274
N-dibenzofuran-2-yl-2,2,2-trifluoroacetamide (PubChem CID 5196274) has the molecular formula C14H8F3NO2 and a molecular weight of 279.22 g/mol. Its IUPAC name is N-dibenzofuran-2-yl-2,2,2-trifluoroacetamide.
| Compound Name | N-dibenzofuran-2-yl-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 5196274 |
| Molecular Formula | C14H8F3NO2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-dibenzofuran-2-yl-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc2oc3ccccc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C14H8F3NO2/c15-14(16,17)13(19)18-8-5-6-12-10(7-8)9-3-1-2-4-11(9)20-12/h1-7H,(H,18,19) |
| InChIKey | ZAPMGRQCCGMDRR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |