C17H12N2O3 — CID 17430004
N-dibenzofuran-2-yl-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 17430004) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is N-dibenzofuran-2-yl-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-dibenzofuran-2-yl-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17430004 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-dibenzofuran-2-yl-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3oc4ccccc4c3c2)no1 |
| InChI | InChI=1S/C17H12N2O3/c1-10-8-14(19-22-10)17(20)18-11-6-7-16-13(9-11)12-4-2-3-5-15(12)21-16/h2-9H,1H3,(H,18,20) |
| InChIKey | IQJCMRHWSJPXRX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |