C18H15N3O2 — CID 17462774
N-dibenzofuran-2-yl-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 17462774) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-dibenzofuran-2-yl-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-dibenzofuran-2-yl-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17462774 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-dibenzofuran-2-yl-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc3oc4ccccc4c3c2)cnn1C |
| InChI | InChI=1S/C18H15N3O2/c1-11-15(10-19-21(11)2)18(22)20-12-7-8-17-14(9-12)13-5-3-4-6-16(13)23-17/h3-10H,1-2H3,(H,20,22) |
| InChIKey | HDCBCDCLKFJMLP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |