C24H17N3O3 — CID 2095361
1-benzyl-N-dibenzofuran-2-yl-6-oxopyridazine-3-carboxamide (PubChem CID 2095361) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-benzyl-N-dibenzofuran-2-yl-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-benzyl-N-dibenzofuran-2-yl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 2095361 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-benzyl-N-dibenzofuran-2-yl-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc2oc3ccccc3c2c1)c1ccc(=O)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C24H17N3O3/c28-23-13-11-20(26-27(23)15-16-6-2-1-3-7-16)24(29)25-17-10-12-22-19(14-17)18-8-4-5-9-21(18)30-22/h1-14H,15H2,(H,25,29) |
| InChIKey | NMCAKCJDGXJFDD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |